Ethyl butyrate, also known as ethyl butanoate, or butyric ether, is an ester with the chemical formula CH3CH2CH2COOCH2CH3, with one oxygen having a double bond. It is soluble in propylene glycol, paraffin oil and kerosene. Ethyl butyrate is present in many fruits e.g. apple, apricot, banana, plum, tangerine etc. Ethyl butyrate is a flavouring ingredient and it can be synthesized by reacting ethanol and butyric acid. This is a condensation reaction, meaning water is produced in the reaction as a byproduct. Ethyl butyrate has been found to be associated with several diseases and/or conditions such as Crohn’s disease (PMID: 23867873 ), ulcerative colitis (PMID: 23867873 ), irritable bowel syndrome (PMID: 23867873 ), celiac disease (PMID: 21970810 ), autism (PMID: 24130822 ), Immunoglobulin A nephropathy (IgAN) (PMID: 24922509 ) and Nonalcoholic fatty liver disease (NAFLD) (PMID: 23454028 ). Specifically, in individuals with Crohn’s disease, ethyl butyrate is significantly reduced in the feces at a concentration of 0.000396 (0.000034-0.00324) nmol/g wet feces (PMID: 23867873 ) compared to normal individuals at a concentration of 2505.202 nmol/g wet feces (PMID: 23867873 ). Similarly, in individuals with ulcerative colitis, ethyl butyrate is significantly reduced in the feces at a concentration of 0.000189 (0-0.00279) nmol/g wet feces (PMID: 23867873 ) compared to normal individuals at a concentration of 2505.202 nmol/g wet feces (PMID: 26416813 ). In individuals with irritable bowel syndrome, ethyl butyrate is significantly reduced in the feces at a concentration of 0.0000086 (0-0.000362) nmol/g wet feces (PMID: 23867873 ) compared to normal individuals at a concentration of 2505.202 nmol/g wet feces (PMID: 26416813 ). However, based on literature, there has not been sufficient quantification for most of these conditions as mentioned above.
Product Name: Ethyl butyrate CAS : 105-54-4Tel: 0086-551-65418679Email: : 0086 158 5698 8503
QQ :2885216886
Wechat: 0086 189 4982 3763WhatsApp: 0086 189 4982 3763
Product List: View Catalog
Main | | ChEBI Ontology | | Automatic Xrefs | | Reactions | | Pathways | | Models | |
| ethyl butyrate | | CHEBI:88764 | | A butyrate ester resulting from the formal condensation of the hydroxy group of ethanol with the carboxy group of butyric acid. | | This entity has been manually annotated by the ChEBI Team. | | | | Molfile XML SDF | | | | InChI=1S/C6H12O2/c1-3-5-6(7)8-4-2/h3-5H2,1-2H3 | OBNCKNCVKJNDBV-UHFFFAOYSA-N | | Physalis peruviana (NCBI:txid126903) | Found in fruit (BTO:0000486). See: PubMed | Citrus sinensis (NCBI:txid2711) | Found in fruit (BTO:0000486). See: PubMed | Mangifera indica (NCBI:txid29780) | Found in ripe fruit (PO:0007038). See: PubMed | Solanum betaceum (NCBI:txid45843) | Found in fruit (BTO:0000486). See: PubMed | Passiflora edulis (NCBI:txid78168) | Found in fruit (BTO:0000486). See: PubMed | Ribes nigrum (NCBI:txid78511) | Found in fruit (BTO:0000486). See: PubMed | Homo sapiens (NCBI:txid9606) | Found in faeces (UBERON:0001988). See: PubMed | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms.
| | View more via ChEBI Ontology Butanoic acid ethyl ester | HMDB | Butyric acid ethyl ester | HMDB | Ethyl 1-butyrate | HMDB | ethyl butanoate | UniProt | Ethyl ester of butanoic acid | HMDB | Ethyl n-butanoate | NIST Chemistry WebBook | Ethyl n-butyrate | ChemIDplus | n-Butyric acid ethyl ester | NIST Chemistry WebBook | 105-54-4 | CAS Registry Number | NIST Chemistry WebBook | 105-54-4 | CAS Registry Number | ChemIDplus | 506331 | Reaxys Registry Number | Reaxys | 15432357 | PubMed citation | Europe PMC | 16131132 | PubMed citation | Europe PMC | 16506838 | PubMed citation | Europe PMC | 19167006 | PubMed citation | Europe PMC | 23305408 | PubMed citation | Europe PMC | 24679778 | PubMed citation | Europe PMC | 24844439 | PubMed citation | Europe PMC | 26471403 | PubMed citation | Europe PMC | 26715051 | PubMed citation | Europe PMC | 27167034 | PubMed citation | Europe PMC | 27440155 | PubMed citation | Europe PMC | 27862955 | PubMed citation | Europe PMC | 27989125 | PubMed citation | Europe PMC | 27999263 | PubMed citation | Europe PMC | 28036078 | PubMed citation | Europe PMC | 28192158 | PubMed citation | Europe PMC | 28285516 | PubMed citation | Europe PMC | 28317768 | PubMed citation | Europe PMC | 28363857 | PubMed citation | Europe PMC | 28476120 | PubMed citation | Europe PMC | 28740317 | PubMed citation | Europe PMC | 28763947 | PubMed citation | Europe PMC | 28784506 | PubMed citation | Europe PMC | 28868973 | PubMed citation | Europe PMC | 28928527 | PubMed citation | Europe PMC | 28992408 | PubMed citation | Europe PMC | 29019010 | PubMed citation | Europe PMC | 727513 | PubMed citation | Europe PMC | IND20363758 | Agricola citation | Europe PMC | IND21978680 | Agricola citation | Europe PMC | IND44476186 | Agricola citation | Europe PMC | IND500604094 | Agricola citation | Europe PMC | IND601124441 | Agricola citation | Europe PMC | |
Privacy Notice and Terms of Use. data-service-id=chebi data-data-protection-version=0.1>